C24H47O7- — CID 22247043
2,3-dihydroxypropyl octadecanoate;2-hydroxypropanoate (PubChem CID 22247043) has the molecular formula C24H47O7- and a molecular weight of 447.63 g/mol. Its IUPAC name is 2,3-dihydroxypropyl octadecanoate;2-hydroxypropanoate.
| Compound Name | 2,3-dihydroxypropyl octadecanoate;2-hydroxypropanoate |
|---|---|
| PubChem CID | 22247043 |
| Molecular Formula | C24H47O7- |
| Molecular Weight | 447.63 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | 2,3-dihydroxypropyl octadecanoate;2-hydroxypropanoate |
| SMILES | CC(O)C(=O)[O-].CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO |
| InChI | InChI=1S/C21H42O4.C3H6O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(24)25-19-20(23)18-22;1-2(4)3(5)6/h20,22-23H,2-19H2,1H3;2,4H,1H3,(H,5,6)/p-1 |
| InChIKey | UESKBWLOSBQYHI-UHFFFAOYSA-M |
| XLogP | 3.26 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.63 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|