C28H32F3N5O2 — CID 22249424
2-[[2-[3-(1-methylpiperidin-4-yl)propoxy]-4-pyridinyl]methylamino]-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 22249424) has the molecular formula C28H32F3N5O2 and a molecular weight of 527.59 g/mol. Its IUPAC name is 2-[[2-[3-(1-methylpiperidin-4-yl)propoxy]-4-pyridinyl]methylamino]-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-[[2-[3-(1-methylpiperidin-4-yl)propoxy]-4-pyridinyl]methylamino]-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 22249424 |
| Molecular Formula | C28H32F3N5O2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 2-[[2-[3-(1-methylpiperidin-4-yl)propoxy]-4-pyridinyl]methylamino]-N-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | CN1CCC(CCCOc2cc(CNc3ncccc3C(=O)Nc3cccc(C(F)(F)F)c3)ccn2)CC1 |
| InChI | InChI=1S/C28H32F3N5O2/c1-36-14-10-20(11-15-36)5-4-16-38-25-17-21(9-13-32-25)19-34-26-24(8-3-12-33-26)27(37)35-23-7-2-6-22(18-23)28(29,30)31/h2-3,6-9,12-13,17-18,20H,4-5,10-11,14-16,19H2,1H3,(H,33,34)(H,35,37) |
| InChIKey | LBNUPUAGNWOLIF-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|