C13H19N2O3S- — CID 2224989
2-(methanesulfonamido)-N-[(2S)-pentan-2-yl]benzenecarboximidate (PubChem CID 2224989) has the molecular formula C13H19N2O3S- and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(methanesulfonamido)-N-[(2S)-pentan-2-yl]benzenecarboximidate.
| Compound Name | 2-(methanesulfonamido)-N-[(2S)-pentan-2-yl]benzenecarboximidate |
|---|---|
| PubChem CID | 2224989 |
| Molecular Formula | C13H19N2O3S- |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(methanesulfonamido)-N-[(2S)-pentan-2-yl]benzenecarboximidate |
| SMILES | CCC[C@H](C)/N=C(\[O-])c1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C13H20N2O3S/c1-4-7-10(2)14-13(16)11-8-5-6-9-12(11)15-19(3,17)18/h5-6,8-10,15H,4,7H2,1-3H3,(H,14,16)/p-1/t10-/m0/s1 |
| InChIKey | VLHGPPSEXLHCOM-JTQLQIEISA-M |
| XLogP | 1.35 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|