C19H22N3O4S- — CID 2236713
N-[(2R)-butan-2-yl]-2-[[2-(methanesulfonamido)benzoyl]amino]benzenecarboximidate (PubChem CID 2236713) has the molecular formula C19H22N3O4S- and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-[[2-(methanesulfonamido)benzoyl]amino]benzenecarboximidate.
| Compound Name | N-[(2R)-butan-2-yl]-2-[[2-(methanesulfonamido)benzoyl]amino]benzenecarboximidate |
|---|---|
| PubChem CID | 2236713 |
| Molecular Formula | C19H22N3O4S- |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-[[2-(methanesulfonamido)benzoyl]amino]benzenecarboximidate |
| SMILES | CC[C@@H](C)/N=C(/[O-])c1ccccc1NC(=O)c1ccccc1NS(C)(=O)=O |
| InChI | InChI=1S/C19H23N3O4S/c1-4-13(2)20-18(23)14-9-5-7-11-16(14)21-19(24)15-10-6-8-12-17(15)22-27(3,25)26/h5-13,22H,4H2,1-3H3,(H,20,23)(H,21,24)/p-1/t13-/m1/s1 |
| InChIKey | BDKDPMZRSIRTCL-CYBMUJFWSA-M |
| XLogP | 2.22 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|