C22H26FNO4S — CID 22250474
3-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]pentanoic acid (PubChem CID 22250474) has the molecular formula C22H26FNO4S and a molecular weight of 419.52 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]pentanoic acid.
| Compound Name | 3-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 22250474 |
| Molecular Formula | C22H26FNO4S |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-yl]pentanoic acid |
| SMILES | CCC(CC(=O)O)C1CCC(c2ccc(F)cc2)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H26FNO4S/c1-3-16(14-22(25)26)20-12-13-21(17-6-8-18(23)9-7-17)24(20)29(27,28)19-10-4-15(2)5-11-19/h4-11,16,20-21H,3,12-14H2,1-2H3,(H,25,26) |
| InChIKey | DQEOMXOZWZRACV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |