About 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one
2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one (PubChem CID 22253698) has the molecular formula C11H24N2O4
and a molecular weight of 248.32 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one |
| PubChem CID | 22253698 |
| Molecular Formula | C11H24N2O4 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one |
| SMILES | CN1CCCC1=O.OCCN(CCO)CCO |
| InChI | InChI=1S/C6H15NO3.C5H9NO/c8-4-1-7(2-5-9)3-6-10;1-6-4-2-3-5(6)7/h8-10H,1-6H2;2-4H2,1H3 |
| InChIKey | AFSUIUDHTDTBLP-UHFFFAOYSA-N |
| XLogP | -1.50 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one?
The IUPAC name of 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one (CID 22253698) is 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one.
What is the SMILES notation for 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one?
The canonical SMILES for 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one is CN1CCCC1=O.OCCN(CCO)CCO.
What is the InChIKey of 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one?
The InChIKey is AFSUIUDHTDTBLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO3.C5H9NO/c8-4-1-7(2-5-9)3-6-10;1-6-4-2-3-5(6)7/h8-10H,1-6H2;2-4H2,1H3.
What are the key properties of 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one?
2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one has a molecular weight of 248.32 g/mol, XLogP of -1.50, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis(2-hydroxyethyl)amino]ethanol;1-methylpyrrolidin-2-one is sourced from PubChem (CID 22253698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).