C12H14N4O — CID 22253755
3-(2,3-diaminophenoxy)benzene-1,2-diamine (PubChem CID 22253755) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 3-(2,3-diaminophenoxy)benzene-1,2-diamine.
| Compound Name | 3-(2,3-diaminophenoxy)benzene-1,2-diamine |
|---|---|
| PubChem CID | 22253755 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 3-(2,3-diaminophenoxy)benzene-1,2-diamine |
| SMILES | Nc1cccc(Oc2cccc(N)c2N)c1N |
| InChI | InChI=1S/C12H14N4O/c13-7-3-1-5-9(11(7)15)17-10-6-2-4-8(14)12(10)16/h1-6H,13-16H2 |
| InChIKey | HWZGZWSHHNWSBP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 113.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|