C15H18N4O3 — CID 2225443
N-[(1S)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-(2-nitrophenyl)acetamide (PubChem CID 2225443) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[(1S)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[(1S)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 2225443 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-[(1S)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-(2-nitrophenyl)acetamide |
| SMILES | Cc1c([C@H](C)NC(=O)Cc2ccccc2[N+](=O)[O-])cnn1C |
| InChI | InChI=1S/C15H18N4O3/c1-10(13-9-16-18(3)11(13)2)17-15(20)8-12-6-4-5-7-14(12)19(21)22/h4-7,9-10H,8H2,1-3H3,(H,17,20)/t10-/m0/s1 |
| InChIKey | SCFUMSHAXIBTQY-JTQLQIEISA-N |
| XLogP | 2.06 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|