C16H21N3O2 — CID 29183103
(2S)-N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-phenoxypropanamide (PubChem CID 29183103) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2S)-N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-phenoxypropanamide.
| Compound Name | (2S)-N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-phenoxypropanamide |
|---|---|
| PubChem CID | 29183103 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2S)-N-[(1R)-1-(1,5-dimethylpyrazol-4-yl)ethyl]-2-phenoxypropanamide |
| SMILES | Cc1c([C@@H](C)NC(=O)[C@H](C)Oc2ccccc2)cnn1C |
| InChI | InChI=1S/C16H21N3O2/c1-11(15-10-17-19(4)12(15)2)18-16(20)13(3)21-14-8-6-5-7-9-14/h5-11,13H,1-4H3,(H,18,20)/t11-,13+/m1/s1 |
| InChIKey | TYCSOKCHKPDWFT-YPMHNXCESA-N |
| XLogP | 2.37 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |