C21H21F3N2O3 — CID 22254576
8-[5-[3-(trifluoromethoxy)phenoxy]pentan-2-yloxy]quinolin-2-amine (PubChem CID 22254576) has the molecular formula C21H21F3N2O3 and a molecular weight of 406.40 g/mol. Its IUPAC name is 8-[5-[3-(trifluoromethoxy)phenoxy]pentan-2-yloxy]quinolin-2-amine.
| Compound Name | 8-[5-[3-(trifluoromethoxy)phenoxy]pentan-2-yloxy]quinolin-2-amine |
|---|---|
| PubChem CID | 22254576 |
| Molecular Formula | C21H21F3N2O3 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | 8-[5-[3-(trifluoromethoxy)phenoxy]pentan-2-yloxy]quinolin-2-amine |
| SMILES | CC(CCCOc1cccc(OC(F)(F)F)c1)Oc1cccc2ccc(N)nc12 |
| InChI | InChI=1S/C21H21F3N2O3/c1-14(28-18-9-2-6-15-10-11-19(25)26-20(15)18)5-4-12-27-16-7-3-8-17(13-16)29-21(22,23)24/h2-3,6-11,13-14H,4-5,12H2,1H3,(H2,25,26) |
| InChIKey | CLBZKKDIOGYZAR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|