C23H27FN6O2 — CID 22254668
N-[4-[4-(4-fluorophenyl)-2-(5-methylidene-1,3-dioxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-yl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 22254668) has the molecular formula C23H27FN6O2 and a molecular weight of 438.51 g/mol. Its IUPAC name is N-[4-[4-(4-fluorophenyl)-2-(5-methylidene-1,3-dioxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-yl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[4-[4-(4-fluorophenyl)-2-(5-methylidene-1,3-dioxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 22254668 |
| Molecular Formula | C23H27FN6O2 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | N-[4-[4-(4-fluorophenyl)-2-(5-methylidene-1,3-dioxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-yl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | C=C1COC(c2nc(-c3ccc(F)cc3)c(-c3ccnc(NCCCN(C)C)n3)[nH]2)OC1 |
| InChI | InChI=1S/C23H27FN6O2/c1-15-13-31-22(32-14-15)21-28-19(16-5-7-17(24)8-6-16)20(29-21)18-9-11-26-23(27-18)25-10-4-12-30(2)3/h5-9,11,22H,1,4,10,12-14H2,2-3H3,(H,28,29)(H,25,26,27) |
| InChIKey | VKWVUQALWJSFNN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|