C24H26FN7O2 — CID 54242439
N-[3-(4,5-dihydroimidazol-1-yl)propyl]-4-[4-(4-fluorophenyl)-2-(5-methylidene-1,3-dioxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-amine (PubChem CID 54242439) has the molecular formula C24H26FN7O2 and a molecular weight of 463.52 g/mol. Its IUPAC name is N-[3-(4,5-dihydroimidazol-1-yl)propyl]-4-[4-(4-fluorophenyl)-2-(5-methylidene-1,3-dioxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-amine.
| Compound Name | N-[3-(4,5-dihydroimidazol-1-yl)propyl]-4-[4-(4-fluorophenyl)-2-(5-methylidene-1,3-dioxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 54242439 |
| Molecular Formula | C24H26FN7O2 |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | N-[3-(4,5-dihydroimidazol-1-yl)propyl]-4-[4-(4-fluorophenyl)-2-(5-methylidene-1,3-dioxan-2-yl)-1H-imidazol-5-yl]pyrimidin-2-amine |
| SMILES | C=C1COC(c2nc(-c3ccc(F)cc3)c(-c3ccnc(NCCCN4C=NCC4)n3)[nH]2)OC1 |
| InChI | InChI=1S/C24H26FN7O2/c1-16-13-33-23(34-14-16)22-30-20(17-3-5-18(25)6-4-17)21(31-22)19-7-9-28-24(29-19)27-8-2-11-32-12-10-26-15-32/h3-7,9,15,23H,1-2,8,10-14H2,(H,30,31)(H,27,28,29) |
| InChIKey | QQYOTTXUVFLHAM-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|