C23H16N2O3 — CID 2225624
(5Z)-5-(1,2-dihydroacenaphthylen-5-ylmethylidene)-1-phenyl-1,3-diazinane-2,4,6-trione (PubChem CID 2225624) has the molecular formula C23H16N2O3 and a molecular weight of 368.39 g/mol. Its IUPAC name is (5Z)-5-(1,2-dihydroacenaphthylen-5-ylmethylidene)-1-phenyl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-5-(1,2-dihydroacenaphthylen-5-ylmethylidene)-1-phenyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2225624 |
| Molecular Formula | C23H16N2O3 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (5Z)-5-(1,2-dihydroacenaphthylen-5-ylmethylidene)-1-phenyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccccc2)C(=O)/C1=C\c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C23H16N2O3/c26-21-19(22(27)25(23(28)24-21)17-6-2-1-3-7-17)13-16-12-11-15-10-9-14-5-4-8-18(16)20(14)15/h1-8,11-13H,9-10H2,(H,24,26,28)/b19-13- |
| InChIKey | IWMKIGYWGYFFMA-UYRXBGFRSA-N |
| XLogP | 3.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|