C37H46O4S2 — CID 22257430
2-dodecylbenzenesulfonate;(2-methoxyphenyl)-diphenylsulfanium (PubChem CID 22257430) has the molecular formula C37H46O4S2 and a molecular weight of 618.91 g/mol. Its IUPAC name is 2-dodecylbenzenesulfonate;(2-methoxyphenyl)-diphenylsulfanium.
| Compound Name | 2-dodecylbenzenesulfonate;(2-methoxyphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 22257430 |
| Molecular Formula | C37H46O4S2 |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 618.28 |
| IUPAC Name | 2-dodecylbenzenesulfonate;(2-methoxyphenyl)-diphenylsulfanium |
| SMILES | CCCCCCCCCCCCc1ccccc1S(=O)(=O)[O-].COc1ccccc1[S+](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17OS.C18H30O3S/c1-20-18-14-8-9-15-19(18)21(16-10-4-2-5-11-16)17-12-6-3-7-13-17;1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)22(19,20)21/h2-15H,1H3;12-13,15-16H,2-11,14H2,1H3,(H,19,20,21)/q+1;/p-1 |
| InChIKey | GKGVQSXKNWJQJX-UHFFFAOYSA-M |
| XLogP | 9.84 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|