C22H23N3O7S2 — CID 2225777
N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-4-(methanesulfonamido)benzamide (PubChem CID 2225777) has the molecular formula C22H23N3O7S2 and a molecular weight of 505.57 g/mol. Its IUPAC name is N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-4-(methanesulfonamido)benzamide.
| Compound Name | N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-4-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 2225777 |
| Molecular Formula | C22H23N3O7S2 |
| Molecular Weight | 505.57 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | N-[4-[(2,5-dimethoxyphenyl)sulfamoyl]phenyl]-4-(methanesulfonamido)benzamide |
| SMILES | COc1ccc(OC)c(NS(=O)(=O)c2ccc(NC(=O)c3ccc(NS(C)(=O)=O)cc3)cc2)c1 |
| InChI | InChI=1S/C22H23N3O7S2/c1-31-18-10-13-21(32-2)20(14-18)25-34(29,30)19-11-8-16(9-12-19)23-22(26)15-4-6-17(7-5-15)24-33(3,27)28/h4-14,24-25H,1-3H3,(H,23,26) |
| InChIKey | GEJVYKCECTVSQT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |