C22H25NO2 — CID 2225872
3-prop-2-enoxy-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide (PubChem CID 2225872) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-prop-2-enoxy-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide.
| Compound Name | 3-prop-2-enoxy-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 2225872 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 3-prop-2-enoxy-N-[(1S)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide |
| SMILES | C=CCOc1cccc(C(=O)N[C@@H](C)c2ccc3c(c2)CCCC3)c1 |
| InChI | InChI=1S/C22H25NO2/c1-3-13-25-21-10-6-9-20(15-21)22(24)23-16(2)18-12-11-17-7-4-5-8-19(17)14-18/h3,6,9-12,14-16H,1,4-5,7-8,13H2,2H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | JGHWUEHQCPRKGT-INIZCTEOSA-N |
| XLogP | 4.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|