C19H20FNO — CID 2941760
3-fluoro-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide (PubChem CID 2941760) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 3-fluoro-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide.
| Compound Name | 3-fluoro-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 2941760 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 3-fluoro-N-[1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cccc(F)c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H20FNO/c1-13(21-19(22)17-7-4-8-18(20)12-17)15-10-9-14-5-2-3-6-16(14)11-15/h4,7-13H,2-3,5-6H2,1H3,(H,21,22) |
| InChIKey | JEFLGOJJSBPPDS-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |