C30H41ClN6O — CID 22260190
N-[4-[4-[3-(3-aminopyrrolidin-1-yl)propyl]piperidin-1-yl]-3-chlorophenyl]-7-methoxy-8-propan-2-ylquinazolin-2-amine (PubChem CID 22260190) has the molecular formula C30H41ClN6O and a molecular weight of 537.15 g/mol. Its IUPAC name is N-[4-[4-[3-(3-aminopyrrolidin-1-yl)propyl]piperidin-1-yl]-3-chlorophenyl]-7-methoxy-8-propan-2-ylquinazolin-2-amine.
| Compound Name | N-[4-[4-[3-(3-aminopyrrolidin-1-yl)propyl]piperidin-1-yl]-3-chlorophenyl]-7-methoxy-8-propan-2-ylquinazolin-2-amine |
|---|---|
| PubChem CID | 22260190 |
| Molecular Formula | C30H41ClN6O |
| Molecular Weight | 537.15 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | N-[4-[4-[3-(3-aminopyrrolidin-1-yl)propyl]piperidin-1-yl]-3-chlorophenyl]-7-methoxy-8-propan-2-ylquinazolin-2-amine |
| SMILES | COc1ccc2cnc(Nc3ccc(N4CCC(CCCN5CCC(N)C5)CC4)c(Cl)c3)nc2c1C(C)C |
| InChI | InChI=1S/C30H41ClN6O/c1-20(2)28-27(38-3)9-6-22-18-33-30(35-29(22)28)34-24-7-8-26(25(31)17-24)37-15-10-21(11-16-37)5-4-13-36-14-12-23(32)19-36/h6-9,17-18,20-21,23H,4-5,10-16,19,32H2,1-3H3,(H,33,34,35) |
| InChIKey | GYMCYCQUUDAXNB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.15 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|