C37H25FN2O2 — CID 22260628
7-fluoro-3-naphthalen-2-yl-1-tritylindazole-5-carboxylic acid (PubChem CID 22260628) has the molecular formula C37H25FN2O2 and a molecular weight of 548.62 g/mol. Its IUPAC name is 7-fluoro-3-naphthalen-2-yl-1-tritylindazole-5-carboxylic acid.
| Compound Name | 7-fluoro-3-naphthalen-2-yl-1-tritylindazole-5-carboxylic acid |
|---|---|
| PubChem CID | 22260628 |
| Molecular Formula | C37H25FN2O2 |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 7-fluoro-3-naphthalen-2-yl-1-tritylindazole-5-carboxylic acid |
| SMILES | O=C(O)c1cc(F)c2c(c1)c(-c1ccc3ccccc3c1)nn2C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H25FN2O2/c38-33-24-28(36(41)42)23-32-34(27-21-20-25-12-10-11-13-26(25)22-27)39-40(35(32)33)37(29-14-4-1-5-15-29,30-16-6-2-7-17-30)31-18-8-3-9-19-31/h1-24H,(H,41,42) |
| InChIKey | ODBNIXGCMIJKNR-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|