C17H8Cl2F8N2O3 — CID 22261259
N-[[2,5-dichloro-4-(1,1,2,2,3,3-hexafluoropropoxy)phenyl]carbamoyl]-2,6-difluorobenzamide (PubChem CID 22261259) has the molecular formula C17H8Cl2F8N2O3 and a molecular weight of 511.15 g/mol. Its IUPAC name is N-[[2,5-dichloro-4-(1,1,2,2,3,3-hexafluoropropoxy)phenyl]carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[[2,5-dichloro-4-(1,1,2,2,3,3-hexafluoropropoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 22261259 |
| Molecular Formula | C17H8Cl2F8N2O3 |
| Molecular Weight | 511.15 g/mol |
| Exact Mass | 509.98 |
| IUPAC Name | N-[[2,5-dichloro-4-(1,1,2,2,3,3-hexafluoropropoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1cc(Cl)c(OC(F)(F)C(F)(F)C(F)F)cc1Cl |
| InChI | InChI=1S/C17H8Cl2F8N2O3/c18-6-5-11(32-17(26,27)16(24,25)14(22)23)7(19)4-10(6)28-15(31)29-13(30)12-8(20)2-1-3-9(12)21/h1-5,14H,(H2,28,29,30,31) |
| InChIKey | JYMJPSPGAXIKGD-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.15 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|