About 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid
4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (PubChem CID 22261528) has the molecular formula C11H11FO2
and a molecular weight of 194.21 g/mol. Its IUPAC name is 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
Analyze 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid?
The IUPAC name of 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid (CID 22261528) is 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid.
What is the SMILES notation for 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid?
The canonical SMILES for 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid is O=C(O)c1ccc(F)c2c1CCCC2.
What is the InChIKey of 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid?
The InChIKey is SQVJXORWLJZXCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FO2/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h5-6H,1-4H2,(H,13,14).
What are the key properties of 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid?
4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid has a molecular weight of 194.21 g/mol, XLogP of 2.40, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5,6,7,8-tetrahydronaphthalene-1-carboxylic acid is sourced from PubChem (CID 22261528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).