C14H16FNO2 — CID 174513546
(7-fluoro-2,3-dihydro-1H-inden-4-yl)-morpholin-2-ylmethanone (PubChem CID 174513546) has the molecular formula C14H16FNO2 and a molecular weight of 249.28 g/mol. Its IUPAC name is (7-fluoro-2,3-dihydro-1H-inden-4-yl)-morpholin-2-ylmethanone.
| Compound Name | (7-fluoro-2,3-dihydro-1H-inden-4-yl)-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 174513546 |
| Molecular Formula | C14H16FNO2 |
| Molecular Weight | 249.28 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | (7-fluoro-2,3-dihydro-1H-inden-4-yl)-morpholin-2-ylmethanone |
| SMILES | O=C(c1ccc(F)c2c1CCC2)C1CNCCO1 |
| InChI | InChI=1S/C14H16FNO2/c15-12-5-4-11(9-2-1-3-10(9)12)14(17)13-8-16-6-7-18-13/h4-5,13,16H,1-3,6-8H2 |
| InChIKey | YJLBZBOLXLAAFW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |