C14H12Cl2N2O2 — CID 175592769
(4,6-dichloroquinolin-3-yl)-morpholin-2-ylmethanone (PubChem CID 175592769) has the molecular formula C14H12Cl2N2O2 and a molecular weight of 311.17 g/mol. Its IUPAC name is (4,6-dichloroquinolin-3-yl)-morpholin-2-ylmethanone.
| Compound Name | (4,6-dichloroquinolin-3-yl)-morpholin-2-ylmethanone |
|---|---|
| PubChem CID | 175592769 |
| Molecular Formula | C14H12Cl2N2O2 |
| Molecular Weight | 311.17 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | (4,6-dichloroquinolin-3-yl)-morpholin-2-ylmethanone |
| SMILES | O=C(c1cnc2ccc(Cl)cc2c1Cl)C1CNCCO1 |
| InChI | InChI=1S/C14H12Cl2N2O2/c15-8-1-2-11-9(5-8)13(16)10(6-18-11)14(19)12-7-17-3-4-20-12/h1-2,5-6,12,17H,3-4,7H2 |
| InChIKey | MGJRSISSNAPSGJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.17 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |