C14H17NO3 — CID 70624241
2,3-dihydro-1H-inden-4-yl morpholine-2-carboxylate (PubChem CID 70624241) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-4-yl morpholine-2-carboxylate.
| Compound Name | 2,3-dihydro-1H-inden-4-yl morpholine-2-carboxylate |
|---|---|
| PubChem CID | 70624241 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2,3-dihydro-1H-inden-4-yl morpholine-2-carboxylate |
| SMILES | O=C(Oc1cccc2c1CCC2)C1CNCCO1 |
| InChI | InChI=1S/C14H17NO3/c16-14(13-9-15-7-8-17-13)18-12-6-2-4-10-3-1-5-11(10)12/h2,4,6,13,15H,1,3,5,7-9H2 |
| InChIKey | NNCWWWVAPRXBEA-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|