C15H19NO2 — CID 82118328
5,6,7,8-tetrahydronaphthalen-1-yl pyrrolidine-2-carboxylate (PubChem CID 82118328) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalen-1-yl pyrrolidine-2-carboxylate.
| Compound Name | 5,6,7,8-tetrahydronaphthalen-1-yl pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 82118328 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalen-1-yl pyrrolidine-2-carboxylate |
| SMILES | O=C(Oc1cccc2c1CCCC2)C1CCCN1 |
| InChI | InChI=1S/C15H19NO2/c17-15(13-8-4-10-16-13)18-14-9-3-6-11-5-1-2-7-12(11)14/h3,6,9,13,16H,1-2,4-5,7-8,10H2 |
| InChIKey | ZHHJTOHCLZBPFQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|