About (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate
(2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate (PubChem CID 91093438) has the molecular formula C11H13NO2
and a molecular weight of 192.24 g/mol. Its IUPAC name is (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate |
| PubChem CID | 91093438 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate |
| SMILES | [2H]c1ccccc1OC(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C11H13NO2/c13-11(10-7-4-8-12-10)14-9-5-2-1-3-6-9/h1-3,5-6,10,12H,4,7-8H2/t10-/m0/s1/i5D |
| InChIKey | QBVBNTIODVFFCG-CIPBNSADSA-N |
| XLogP | 1.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate?
The IUPAC name of (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate (CID 91093438) is (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate.
What is the SMILES notation for (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate?
The canonical SMILES for (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate is [2H]c1ccccc1OC(=O)[C@@H]1CCCN1.
What is the InChIKey of (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate?
The InChIKey is QBVBNTIODVFFCG-CIPBNSADSA-N. The full InChI is InChI=1S/C11H13NO2/c13-11(10-7-4-8-12-10)14-9-5-2-1-3-6-9/h1-3,5-6,10,12H,4,7-8H2/t10-/m0/s1/i5D.
What are the key properties of (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate?
(2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate has a molecular weight of 192.24 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-deuteriophenyl) (2S)-pyrrolidine-2-carboxylate is sourced from PubChem (CID 91093438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).