C23H30FN2O5+ — CID 22264057
1-[4-[(4-fluorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]-2-(3,4,5-trimethoxyphenoxy)ethanone (PubChem CID 22264057) has the molecular formula C23H30FN2O5+ and a molecular weight of 433.50 g/mol. Its IUPAC name is 1-[4-[(4-fluorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]-2-(3,4,5-trimethoxyphenoxy)ethanone.
| Compound Name | 1-[4-[(4-fluorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]-2-(3,4,5-trimethoxyphenoxy)ethanone |
|---|---|
| PubChem CID | 22264057 |
| Molecular Formula | C23H30FN2O5+ |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-[4-[(4-fluorophenyl)methyl]-4-methylpiperazin-4-ium-1-yl]-2-(3,4,5-trimethoxyphenoxy)ethanone |
| SMILES | COc1cc(OCC(=O)N2CC[N+](C)(Cc3ccc(F)cc3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C23H30FN2O5/c1-26(15-17-5-7-18(24)8-6-17)11-9-25(10-12-26)22(27)16-31-19-13-20(28-2)23(30-4)21(14-19)29-3/h5-8,13-14H,9-12,15-16H2,1-4H3/q+1 |
| InChIKey | VJWULYZIXJGUIQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|