C20H21ClFNO4 — CID 90941147
2-(4-chloro-3-methoxyphenoxy)-1-[4-(4-fluorophenoxy)piperidin-1-yl]ethanone (PubChem CID 90941147) has the molecular formula C20H21ClFNO4 and a molecular weight of 393.84 g/mol. Its IUPAC name is 2-(4-chloro-3-methoxyphenoxy)-1-[4-(4-fluorophenoxy)piperidin-1-yl]ethanone.
| Compound Name | 2-(4-chloro-3-methoxyphenoxy)-1-[4-(4-fluorophenoxy)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90941147 |
| Molecular Formula | C20H21ClFNO4 |
| Molecular Weight | 393.84 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 2-(4-chloro-3-methoxyphenoxy)-1-[4-(4-fluorophenoxy)piperidin-1-yl]ethanone |
| SMILES | COc1cc(OCC(=O)N2CCC(Oc3ccc(F)cc3)CC2)ccc1Cl |
| InChI | InChI=1S/C20H21ClFNO4/c1-25-19-12-17(6-7-18(19)21)26-13-20(24)23-10-8-16(9-11-23)27-15-4-2-14(22)3-5-15/h2-7,12,16H,8-11,13H2,1H3 |
| InChIKey | MXVDXOHNHRYAKQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.84 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |