C21H22ClFN2O4 — CID 59367894
(6-chloro-7-methoxy-3,4-dihydro-2H-1,4-benzoxazin-2-yl)-[4-(4-fluorophenoxy)piperidin-1-yl]methanone (PubChem CID 59367894) has the molecular formula C21H22ClFN2O4 and a molecular weight of 420.87 g/mol. Its IUPAC name is (6-chloro-7-methoxy-3,4-dihydro-2H-1,4-benzoxazin-2-yl)-[4-(4-fluorophenoxy)piperidin-1-yl]methanone.
| Compound Name | (6-chloro-7-methoxy-3,4-dihydro-2H-1,4-benzoxazin-2-yl)-[4-(4-fluorophenoxy)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 59367894 |
| Molecular Formula | C21H22ClFN2O4 |
| Molecular Weight | 420.87 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | (6-chloro-7-methoxy-3,4-dihydro-2H-1,4-benzoxazin-2-yl)-[4-(4-fluorophenoxy)piperidin-1-yl]methanone |
| SMILES | COc1cc2c(cc1Cl)NCC(C(=O)N1CCC(Oc3ccc(F)cc3)CC1)O2 |
| InChI | InChI=1S/C21H22ClFN2O4/c1-27-18-11-19-17(10-16(18)22)24-12-20(29-19)21(26)25-8-6-15(7-9-25)28-14-4-2-13(23)3-5-14/h2-5,10-11,15,20,24H,6-9,12H2,1H3 |
| InChIKey | BQNGIJKUODTSBU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.87 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|