C20H19Br2ClN2O3 — CID 22264399
3,5-dibromo-2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]benzaldehyde (PubChem CID 22264399) has the molecular formula C20H19Br2ClN2O3 and a molecular weight of 530.64 g/mol. Its IUPAC name is 3,5-dibromo-2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]benzaldehyde.
| Compound Name | 3,5-dibromo-2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]benzaldehyde |
|---|---|
| PubChem CID | 22264399 |
| Molecular Formula | C20H19Br2ClN2O3 |
| Molecular Weight | 530.64 g/mol |
| Exact Mass | 527.95 |
| IUPAC Name | 3,5-dibromo-2-[2-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-oxoethoxy]benzaldehyde |
| SMILES | O=Cc1cc(Br)cc(Br)c1OCC(=O)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H19Br2ClN2O3/c21-16-9-15(12-26)20(18(22)10-16)28-13-19(27)25-7-5-24(6-8-25)11-14-1-3-17(23)4-2-14/h1-4,9-10,12H,5-8,11,13H2 |
| InChIKey | FAOLJEQMJWDAQO-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.64 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|