C22H24ClN3O5 — CID 22264457
2-(2-acetyl-4-methyl-6-nitrophenoxy)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanone (PubChem CID 22264457) has the molecular formula C22H24ClN3O5 and a molecular weight of 445.90 g/mol. Its IUPAC name is 2-(2-acetyl-4-methyl-6-nitrophenoxy)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(2-acetyl-4-methyl-6-nitrophenoxy)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 22264457 |
| Molecular Formula | C22H24ClN3O5 |
| Molecular Weight | 445.90 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-(2-acetyl-4-methyl-6-nitrophenoxy)-1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)c1cc(C)cc([N+](=O)[O-])c1OCC(=O)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H24ClN3O5/c1-15-11-19(16(2)27)22(20(12-15)26(29)30)31-14-21(28)25-9-7-24(8-10-25)13-17-3-5-18(23)6-4-17/h3-6,11-12H,7-10,13-14H2,1-2H3 |
| InChIKey | YAMIVGLMDNUNJN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|