C22H22ClN3O3 — CID 22264482
1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-(6-hydroxyquinolin-2-yl)oxyethanone (PubChem CID 22264482) has the molecular formula C22H22ClN3O3 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-(6-hydroxyquinolin-2-yl)oxyethanone.
| Compound Name | 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-(6-hydroxyquinolin-2-yl)oxyethanone |
|---|---|
| PubChem CID | 22264482 |
| Molecular Formula | C22H22ClN3O3 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)methyl]piperazin-1-yl]-2-(6-hydroxyquinolin-2-yl)oxyethanone |
| SMILES | O=C(COc1ccc2cc(O)ccc2n1)N1CCN(Cc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H22ClN3O3/c23-18-4-1-16(2-5-18)14-25-9-11-26(12-10-25)22(28)15-29-21-8-3-17-13-19(27)6-7-20(17)24-21/h1-8,13,27H,9-12,14-15H2 |
| InChIKey | YUOWNOQOHDPQML-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |