C18H22BrN3O2 — CID 22266501
1-(2-bromophenyl)-3-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)urea (PubChem CID 22266501) has the molecular formula C18H22BrN3O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 1-(2-bromophenyl)-3-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)urea.
| Compound Name | 1-(2-bromophenyl)-3-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)urea |
|---|---|
| PubChem CID | 22266501 |
| Molecular Formula | C18H22BrN3O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 1-(2-bromophenyl)-3-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)urea |
| SMILES | CCCCn1c(C)c(C)cc(NC(=O)Nc2ccccc2Br)c1=O |
| InChI | InChI=1S/C18H22BrN3O2/c1-4-5-10-22-13(3)12(2)11-16(17(22)23)21-18(24)20-15-9-7-6-8-14(15)19/h6-9,11H,4-5,10H2,1-3H3,(H2,20,21,24) |
| InChIKey | GZGOBDYWXQKLGP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |