C18H23N3O2 — CID 71660058
1-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)-3-phenylurea (PubChem CID 71660058) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)-3-phenylurea.
| Compound Name | 1-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)-3-phenylurea |
|---|---|
| PubChem CID | 71660058 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-(1-butyl-5,6-dimethyl-2-oxo-3-pyridinyl)-3-phenylurea |
| SMILES | CCCCn1c(C)c(C)cc(NC(=O)Nc2ccccc2)c1=O |
| InChI | InChI=1S/C18H23N3O2/c1-4-5-11-21-14(3)13(2)12-16(17(21)22)20-18(23)19-15-9-7-6-8-10-15/h6-10,12H,4-5,11H2,1-3H3,(H2,19,20,23) |
| InChIKey | MWDDWMBCCKCMRL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |