C30H52O6 — CID 22266996
1-butoxyethyl 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate (PubChem CID 22266996) has the molecular formula C30H52O6 and a molecular weight of 508.74 g/mol. Its IUPAC name is 1-butoxyethyl 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate.
| Compound Name | 1-butoxyethyl 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
|---|---|
| PubChem CID | 22266996 |
| Molecular Formula | C30H52O6 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | 1-butoxyethyl 4-(3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
| SMILES | CCCCOC(C)OC(=O)CCC(C)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C30H52O6/c1-6-7-14-35-19(3)36-27(34)11-8-18(2)22-9-10-23-28-24(17-26(33)30(22,23)5)29(4)13-12-21(31)15-20(29)16-25(28)32/h18-26,28,31-33H,6-17H2,1-5H3 |
| InChIKey | LAOHGTITEOKJPN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|