C27H36F3N5O3 — CID 22268866
3-amino-N-[2-[[1-(tert-butylamino)-4-[(4-ethylphenyl)methylamino]-1-oxobutan-2-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 22268866) has the molecular formula C27H36F3N5O3 and a molecular weight of 535.61 g/mol. Its IUPAC name is 3-amino-N-[2-[[1-(tert-butylamino)-4-[(4-ethylphenyl)methylamino]-1-oxobutan-2-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-amino-N-[2-[[1-(tert-butylamino)-4-[(4-ethylphenyl)methylamino]-1-oxobutan-2-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 22268866 |
| Molecular Formula | C27H36F3N5O3 |
| Molecular Weight | 535.61 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 3-amino-N-[2-[[1-(tert-butylamino)-4-[(4-ethylphenyl)methylamino]-1-oxobutan-2-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CCc1ccc(CNCCC(NC(=O)CNC(=O)c2cc(N)cc(C(F)(F)F)c2)C(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H36F3N5O3/c1-5-17-6-8-18(9-7-17)15-32-11-10-22(25(38)35-26(2,3)4)34-23(36)16-33-24(37)19-12-20(27(28,29)30)14-21(31)13-19/h6-9,12-14,22,32H,5,10-11,15-16,31H2,1-4H3,(H,33,37)(H,34,36)(H,35,38) |
| InChIKey | LWEYMQQVLUOWLP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|