C26H30N2O2 — CID 22269735
2-[2-[3-[4-(diethylamino)phenyl]propyl]anilino]benzoic acid (PubChem CID 22269735) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-[2-[3-[4-(diethylamino)phenyl]propyl]anilino]benzoic acid.
| Compound Name | 2-[2-[3-[4-(diethylamino)phenyl]propyl]anilino]benzoic acid |
|---|---|
| PubChem CID | 22269735 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-[2-[3-[4-(diethylamino)phenyl]propyl]anilino]benzoic acid |
| SMILES | CCN(CC)c1ccc(CCCc2ccccc2Nc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C26H30N2O2/c1-3-28(4-2)22-18-16-20(17-19-22)10-9-12-21-11-5-7-14-24(21)27-25-15-8-6-13-23(25)26(29)30/h5-8,11,13-19,27H,3-4,9-10,12H2,1-2H3,(H,29,30) |
| InChIKey | ABCNESMSSAUTCS-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|