C18H19NO4 — CID 23333596
2-[[4-(carboxymethyl)-N-ethylanilino]methyl]benzoic acid (PubChem CID 23333596) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 2-[[4-(carboxymethyl)-N-ethylanilino]methyl]benzoic acid.
| Compound Name | 2-[[4-(carboxymethyl)-N-ethylanilino]methyl]benzoic acid |
|---|---|
| PubChem CID | 23333596 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-[[4-(carboxymethyl)-N-ethylanilino]methyl]benzoic acid |
| SMILES | CCN(Cc1ccccc1C(=O)O)c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-2-19(12-14-5-3-4-6-16(14)18(22)23)15-9-7-13(8-10-15)11-17(20)21/h3-10H,2,11-12H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | ZRLQCOKVBBUAMG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|