C9H9F3N2O3 — CID 22270642
2-methyl-2-[6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoic acid (PubChem CID 22270642) has the molecular formula C9H9F3N2O3 and a molecular weight of 250.18 g/mol. Its IUPAC name is 2-methyl-2-[6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoic acid.
| Compound Name | 2-methyl-2-[6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 22270642 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-methyl-2-[6-(trifluoromethyl)pyrimidin-4-yl]oxypropanoic acid |
| SMILES | CC(C)(Oc1cc(C(F)(F)F)ncn1)C(=O)O |
| InChI | InChI=1S/C9H9F3N2O3/c1-8(2,7(15)16)17-6-3-5(9(10,11)12)13-4-14-6/h3-4H,1-2H3,(H,15,16) |
| InChIKey | WNLKFFVWZDIHOZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |