C15H20ClF3N2O5 — CID 171557911
tert-butyl 2-[2-[2-[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetate (PubChem CID 171557911) has the molecular formula C15H20ClF3N2O5 and a molecular weight of 400.78 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 171557911 |
| Molecular Formula | C15H20ClF3N2O5 |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 400.10 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-chloro-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOc1cc(C(F)(F)F)nc(Cl)n1 |
| InChI | InChI=1S/C15H20ClF3N2O5/c1-14(2,3)26-12(22)9-24-5-4-23-6-7-25-11-8-10(15(17,18)19)20-13(16)21-11/h8H,4-7,9H2,1-3H3 |
| InChIKey | MDXHKCOUUUHCOF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 79.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|