C13H12N2 — CID 22271746
bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-1,3-dimethylpyrazole (PubChem CID 22271746) has the molecular formula C13H12N2 and a molecular weight of 196.25 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-1,3-dimethylpyrazole.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-1,3-dimethylpyrazole |
|---|---|
| PubChem CID | 22271746 |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;4-ethynyl-1,3-dimethylpyrazole |
| SMILES | C#Cc1cn(C)nc1C.c1cc2cc-2c1 |
| InChI | InChI=1S/C7H8N2.C6H4/c1-4-7-5-9(3)8-6(7)2;1-2-5-4-6(5)3-1/h1,5H,2-3H3;1-4H |
| InChIKey | KGESCTPWNNSFOG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|