C19H23N3O — CID 22274535
1-methyl-4-[2-[2-(2-methylpyrrolidin-1-yl)ethyl]-1-benzofuran-7-yl]imidazole (PubChem CID 22274535) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is 1-methyl-4-[2-[2-(2-methylpyrrolidin-1-yl)ethyl]-1-benzofuran-7-yl]imidazole.
| Compound Name | 1-methyl-4-[2-[2-(2-methylpyrrolidin-1-yl)ethyl]-1-benzofuran-7-yl]imidazole |
|---|---|
| PubChem CID | 22274535 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 1-methyl-4-[2-[2-(2-methylpyrrolidin-1-yl)ethyl]-1-benzofuran-7-yl]imidazole |
| SMILES | CC1CCCN1CCc1cc2cccc(-c3cn(C)cn3)c2o1 |
| InChI | InChI=1S/C19H23N3O/c1-14-5-4-9-22(14)10-8-16-11-15-6-3-7-17(19(15)23-16)18-12-21(2)13-20-18/h3,6-7,11-14H,4-5,8-10H2,1-2H3 |
| InChIKey | HNGPWXZIXJADNH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 34.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |