C18H15NO2 — CID 22274607
3-[2-(3-hydroxypropyl)-1-benzofuran-5-yl]benzonitrile (PubChem CID 22274607) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3-[2-(3-hydroxypropyl)-1-benzofuran-5-yl]benzonitrile.
| Compound Name | 3-[2-(3-hydroxypropyl)-1-benzofuran-5-yl]benzonitrile |
|---|---|
| PubChem CID | 22274607 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-[2-(3-hydroxypropyl)-1-benzofuran-5-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc3oc(CCCO)cc3c2)c1 |
| InChI | InChI=1S/C18H15NO2/c19-12-13-3-1-4-14(9-13)15-6-7-18-16(10-15)11-17(21-18)5-2-8-20/h1,3-4,6-7,9-11,20H,2,5,8H2 |
| InChIKey | BZVTXUDFEXUHOZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |