C27H24FN3O — CID 24736187
3-[[4-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]methyl]benzonitrile (PubChem CID 24736187) has the molecular formula C27H24FN3O and a molecular weight of 425.51 g/mol. Its IUPAC name is 3-[[4-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]methyl]benzonitrile.
| Compound Name | 3-[[4-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 24736187 |
| Molecular Formula | C27H24FN3O |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | 3-[[4-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]piperazin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CN2CCN(Cc3cc4cc(-c5cccc(F)c5)ccc4o3)CC2)c1 |
| InChI | InChI=1S/C27H24FN3O/c28-25-6-2-5-22(15-25)23-7-8-27-24(14-23)16-26(32-27)19-31-11-9-30(10-12-31)18-21-4-1-3-20(13-21)17-29/h1-8,13-16H,9-12,18-19H2 |
| InChIKey | LDSMDEHYMAOURB-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 43.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |