C27H27FN2O2 — CID 24736188
1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-[(4-methoxyphenyl)methyl]piperazine (PubChem CID 24736188) has the molecular formula C27H27FN2O2 and a molecular weight of 430.52 g/mol. Its IUPAC name is 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-[(4-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-[(4-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 24736188 |
| Molecular Formula | C27H27FN2O2 |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-[(4-methoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCN(Cc3cc4cc(-c5cccc(F)c5)ccc4o3)CC2)cc1 |
| InChI | InChI=1S/C27H27FN2O2/c1-31-25-8-5-20(6-9-25)18-29-11-13-30(14-12-29)19-26-17-23-15-22(7-10-27(23)32-26)21-3-2-4-24(28)16-21/h2-10,15-17H,11-14,18-19H2,1H3 |
| InChIKey | IIDYGTHSTVPNAN-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |