C23H21FN2O3S2 — CID 24736176
1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-thiophen-2-ylsulfonylpiperazine (PubChem CID 24736176) has the molecular formula C23H21FN2O3S2 and a molecular weight of 456.56 g/mol. Its IUPAC name is 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-thiophen-2-ylsulfonylpiperazine.
| Compound Name | 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 24736176 |
| Molecular Formula | C23H21FN2O3S2 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-thiophen-2-ylsulfonylpiperazine |
| SMILES | O=S(=O)(c1cccs1)N1CCN(Cc2cc3cc(-c4cccc(F)c4)ccc3o2)CC1 |
| InChI | InChI=1S/C23H21FN2O3S2/c24-20-4-1-3-17(14-20)18-6-7-22-19(13-18)15-21(29-22)16-25-8-10-26(11-9-25)31(27,28)23-5-2-12-30-23/h1-7,12-15H,8-11,16H2 |
| InChIKey | OWSSGKMAUZKJAN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |