About 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane
1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane (PubChem CID 24737280) has the molecular formula C21H23FN2O3S
and a molecular weight of 402.49 g/mol. Its IUPAC name is 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane |
| PubChem CID | 24737280 |
| Molecular Formula | C21H23FN2O3S |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane |
| SMILES | CS(=O)(=O)N1CCCN(Cc2cc3cc(-c4cccc(F)c4)ccc3o2)CC1 |
| InChI | InChI=1S/C21H23FN2O3S/c1-28(25,26)24-9-3-8-23(10-11-24)15-20-14-18-12-17(6-7-21(18)27-20)16-4-2-5-19(22)13-16/h2,4-7,12-14H,3,8-11,15H2,1H3 |
| InChIKey | IIVSBKRBWBXRKD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane?
The IUPAC name of 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane (CID 24737280) is 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane.
What is the SMILES notation for 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane?
The canonical SMILES for 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane is CS(=O)(=O)N1CCCN(Cc2cc3cc(-c4cccc(F)c4)ccc3o2)CC1.
What is the InChIKey of 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane?
The InChIKey is IIVSBKRBWBXRKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN2O3S/c1-28(25,26)24-9-3-8-23(10-11-24)15-20-14-18-12-17(6-7-21(18)27-20)16-4-2-5-19(22)13-16/h2,4-7,12-14H,3,8-11,15H2,1H3.
What are the key properties of 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane?
1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane has a molecular weight of 402.49 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[5-(3-fluorophenyl)-1-benzofuran-2-yl]methyl]-4-methylsulfonyl-1,4-diazepane is sourced from PubChem (CID 24737280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).