C21H21N5O4S2 — CID 22278669
4-[7-[(2-methyl-1H-indol-5-yl)amino]thieno[3,2-b]pyridine-2-carbonyl]piperazine-1-sulfonic acid (PubChem CID 22278669) has the molecular formula C21H21N5O4S2 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-[7-[(2-methyl-1H-indol-5-yl)amino]thieno[3,2-b]pyridine-2-carbonyl]piperazine-1-sulfonic acid.
| Compound Name | 4-[7-[(2-methyl-1H-indol-5-yl)amino]thieno[3,2-b]pyridine-2-carbonyl]piperazine-1-sulfonic acid |
|---|---|
| PubChem CID | 22278669 |
| Molecular Formula | C21H21N5O4S2 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | 4-[7-[(2-methyl-1H-indol-5-yl)amino]thieno[3,2-b]pyridine-2-carbonyl]piperazine-1-sulfonic acid |
| SMILES | Cc1cc2cc(Nc3ccnc4cc(C(=O)N5CCN(S(=O)(=O)O)CC5)sc34)ccc2[nH]1 |
| InChI | InChI=1S/C21H21N5O4S2/c1-13-10-14-11-15(2-3-16(14)23-13)24-17-4-5-22-18-12-19(31-20(17)18)21(27)25-6-8-26(9-7-25)32(28,29)30/h2-5,10-12,23H,6-9H2,1H3,(H,22,24)(H,28,29,30) |
| InChIKey | YZHMFNYTBZSCCS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 118.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|