C22H18N4O3S2 — CID 141009750
[2-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]-5-methylphenyl]sulfamic acid (PubChem CID 141009750) has the molecular formula C22H18N4O3S2 and a molecular weight of 450.55 g/mol. Its IUPAC name is [2-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]-5-methylphenyl]sulfamic acid.
| Compound Name | [2-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]-5-methylphenyl]sulfamic acid |
|---|---|
| PubChem CID | 141009750 |
| Molecular Formula | C22H18N4O3S2 |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | [2-[7-(1H-indol-5-ylamino)thieno[3,2-b]pyridin-2-yl]-5-methylphenyl]sulfamic acid |
| SMILES | Cc1ccc(-c2cc3nccc(Nc4ccc5[nH]ccc5c4)c3s2)c(NS(=O)(=O)O)c1 |
| InChI | InChI=1S/C22H18N4O3S2/c1-13-2-4-16(19(10-13)26-31(27,28)29)21-12-20-22(30-21)18(7-9-24-20)25-15-3-5-17-14(11-15)6-8-23-17/h2-12,23,26H,1H3,(H,24,25)(H,27,28,29) |
| InChIKey | CDVKYDAGFMPQPT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|