C24H22N4OS — CID 91298049
2-[[4-[4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]phenyl]methylamino]ethanol (PubChem CID 91298049) has the molecular formula C24H22N4OS and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-[[4-[4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]phenyl]methylamino]ethanol.
| Compound Name | 2-[[4-[4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 91298049 |
| Molecular Formula | C24H22N4OS |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 2-[[4-[4-(1H-indol-5-ylamino)thieno[2,3-b]pyridin-2-yl]phenyl]methylamino]ethanol |
| SMILES | OCCNCc1ccc(-c2cc3c(Nc4ccc5[nH]ccc5c4)ccnc3s2)cc1 |
| InChI | InChI=1S/C24H22N4OS/c29-12-11-25-15-16-1-3-17(4-2-16)23-14-20-22(8-10-27-24(20)30-23)28-19-5-6-21-18(13-19)7-9-26-21/h1-10,13-14,25-26,29H,11-12,15H2,(H,27,28) |
| InChIKey | QPKGDEQGXLFRKO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|